C18H21N3O5 — CID 21460836
propanedioic acid;4-(prop-2-enylamino)-1,3,4,5-tetrahydrobenzo[cd]indole-6-carboxamide (PubChem CID 21460836) has the molecular formula C18H21N3O5 and a molecular weight of 359.38 g/mol. Its IUPAC name is propanedioic acid;4-(prop-2-enylamino)-1,3,4,5-tetrahydrobenzo[cd]indole-6-carboxamide.
| Compound Name | propanedioic acid;4-(prop-2-enylamino)-1,3,4,5-tetrahydrobenzo[cd]indole-6-carboxamide |
|---|---|
| PubChem CID | 21460836 |
| Molecular Formula | C18H21N3O5 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | propanedioic acid;4-(prop-2-enylamino)-1,3,4,5-tetrahydrobenzo[cd]indole-6-carboxamide |
| SMILES | C=CCNC1Cc2c[nH]c3ccc(C(N)=O)c(c23)C1.O=C(O)CC(=O)O |
| InChI | InChI=1S/C15H17N3O.C3H4O4/c1-2-5-17-10-6-9-8-18-13-4-3-11(15(16)19)12(7-10)14(9)13;4-2(5)1-3(6)7/h2-4,8,10,17-18H,1,5-7H2,(H2,16,19);1H2,(H,4,5)(H,6,7) |
| InChIKey | LXRLZCPVSDZRAA-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 145.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|