C18H24N2 — CID 102268620
(4S,5S)-5-(2-methylprop-1-enyl)-N-propyl-1,3,4,5-tetrahydrobenzo[cd]indol-4-amine (PubChem CID 102268620) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is (4S,5S)-5-(2-methylprop-1-enyl)-N-propyl-1,3,4,5-tetrahydrobenzo[cd]indol-4-amine.
| Compound Name | (4S,5S)-5-(2-methylprop-1-enyl)-N-propyl-1,3,4,5-tetrahydrobenzo[cd]indol-4-amine |
|---|---|
| PubChem CID | 102268620 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | (4S,5S)-5-(2-methylprop-1-enyl)-N-propyl-1,3,4,5-tetrahydrobenzo[cd]indol-4-amine |
| SMILES | CCCN[C@H]1Cc2c[nH]c3cccc(c23)[C@@H]1C=C(C)C |
| InChI | InChI=1S/C18H24N2/c1-4-8-19-17-10-13-11-20-16-7-5-6-14(18(13)16)15(17)9-12(2)3/h5-7,9,11,15,17,19-20H,4,8,10H2,1-3H3/t15-,17-/m0/s1 |
| InChIKey | AYXJPVCLHRVBSU-RDJZCZTQSA-N |
| XLogP | 4.14 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|