C24H28N2O2 — CID 19828707
[4-(dipropylamino)-1,3,4,5-tetrahydrobenzo[cd]indol-6-yl] benzoate (PubChem CID 19828707) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is [4-(dipropylamino)-1,3,4,5-tetrahydrobenzo[cd]indol-6-yl] benzoate.
| Compound Name | [4-(dipropylamino)-1,3,4,5-tetrahydrobenzo[cd]indol-6-yl] benzoate |
|---|---|
| PubChem CID | 19828707 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | [4-(dipropylamino)-1,3,4,5-tetrahydrobenzo[cd]indol-6-yl] benzoate |
| SMILES | CCCN(CCC)C1Cc2c[nH]c3ccc(OC(=O)c4ccccc4)c(c23)C1 |
| InChI | InChI=1S/C24H28N2O2/c1-3-12-26(13-4-2)19-14-18-16-25-21-10-11-22(20(15-19)23(18)21)28-24(27)17-8-6-5-7-9-17/h5-11,16,19,25H,3-4,12-15H2,1-2H3 |
| InChIKey | RDQNKPJOSNHPDY-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|