C12H18O — CID 130037426
5,7-dimethyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-one (PubChem CID 130037426) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is 5,7-dimethyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-one.
| Compound Name | 5,7-dimethyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-one |
|---|---|
| PubChem CID | 130037426 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 5,7-dimethyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-one |
| SMILES | CC1CC2=CC(=O)CCC2C(C)C1 |
| InChI | InChI=1S/C12H18O/c1-8-5-9(2)12-4-3-11(13)7-10(12)6-8/h7-9,12H,3-6H2,1-2H3 |
| InChIKey | STTPJRRTLFULCO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |