C15H24O — CID 148668363
(4R,6R)-6-tert-butyl-4-methyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-one (PubChem CID 148668363) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is (4R,6R)-6-tert-butyl-4-methyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-one.
| Compound Name | (4R,6R)-6-tert-butyl-4-methyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-one |
|---|---|
| PubChem CID | 148668363 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | (4R,6R)-6-tert-butyl-4-methyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-one |
| SMILES | C[C@@H]1CC(=O)C=C2CC[C@@H](C(C)(C)C)CC21 |
| InChI | InChI=1S/C15H24O/c1-10-7-13(16)8-11-5-6-12(9-14(10)11)15(2,3)4/h8,10,12,14H,5-7,9H2,1-4H3/t10-,12-,14?/m1/s1 |
| InChIKey | NPEWVIACCSYRRQ-RMPUTMTLSA-N |
| XLogP | 3.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |