C11H16O — CID 54442326
7-ethyl-1,2,3,6,7,7a-hexahydroinden-5-one (PubChem CID 54442326) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is 7-ethyl-1,2,3,6,7,7a-hexahydroinden-5-one.
| Compound Name | 7-ethyl-1,2,3,6,7,7a-hexahydroinden-5-one |
|---|---|
| PubChem CID | 54442326 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | 7-ethyl-1,2,3,6,7,7a-hexahydroinden-5-one |
| SMILES | CCC1CC(=O)C=C2CCCC21 |
| InChI | InChI=1S/C11H16O/c1-2-8-6-10(12)7-9-4-3-5-11(8)9/h7-8,11H,2-6H2,1H3 |
| InChIKey | WOZUMFWCBQENDW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |