C10H17ClO — CID 641779
cis-(2S,4R)-4-tert-butyl-2-chlorocyclohexan-1-one (PubChem CID 641779) has the molecular formula C10H17ClO and a molecular weight of 188.70 g/mol. Its IUPAC name is cis-(2S,4R)-4-tert-butyl-2-chlorocyclohexan-1-one.
| Compound Name | cis-(2S,4R)-4-tert-butyl-2-chlorocyclohexan-1-one |
|---|---|
| PubChem CID | 641779 |
| Molecular Formula | C10H17ClO |
| Molecular Weight | 188.70 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | cis-(2S,4R)-4-tert-butyl-2-chlorocyclohexan-1-one |
| SMILES | CC(C)(C)[C@@H]1CCC(=O)[C@@H](Cl)C1 |
| InChI | InChI=1S/C10H17ClO/c1-10(2,3)7-4-5-9(12)8(11)6-7/h7-8H,4-6H2,1-3H3/t7-,8+/m1/s1 |
| InChIKey | FJAHXLMRHNSHHX-SFYZADRCSA-N |
| XLogP | 3.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.70 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|