C11H18O3 — CID 28744023
cis-(1S,5R)-5-tert-butyl-2-oxocyclohexane-1-carboxylic acid (PubChem CID 28744023) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is cis-(1S,5R)-5-tert-butyl-2-oxocyclohexane-1-carboxylic acid.
| Compound Name | cis-(1S,5R)-5-tert-butyl-2-oxocyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 28744023 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | cis-(1S,5R)-5-tert-butyl-2-oxocyclohexane-1-carboxylic acid |
| SMILES | CC(C)(C)[C@@H]1CCC(=O)[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C11H18O3/c1-11(2,3)7-4-5-9(12)8(6-7)10(13)14/h7-8H,4-6H2,1-3H3,(H,13,14)/t7-,8+/m1/s1 |
| InChIKey | XIFTXKJKXFSKAS-SFYZADRCSA-N |
| XLogP | 2.10 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|