C20H28O — CID 70147149
(1R,7R,10R,11R)-7,18-dimethylpentacyclo[8.8.0.02,4.02,7.011,16]octadec-15-en-14-one (PubChem CID 70147149) has the molecular formula C20H28O and a molecular weight of 284.44 g/mol. Its IUPAC name is (1R,7R,10R,11R)-7,18-dimethylpentacyclo[8.8.0.02,4.02,7.011,16]octadec-15-en-14-one.
| Compound Name | (1R,7R,10R,11R)-7,18-dimethylpentacyclo[8.8.0.02,4.02,7.011,16]octadec-15-en-14-one |
|---|---|
| PubChem CID | 70147149 |
| Molecular Formula | C20H28O |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | (1R,7R,10R,11R)-7,18-dimethylpentacyclo[8.8.0.02,4.02,7.011,16]octadec-15-en-14-one |
| SMILES | CC1CC2=CC(=O)CC[C@@H]2[C@H]2CC[C@]3(C)CCC4CC43[C@H]12 |
| InChI | InChI=1S/C20H28O/c1-12-9-13-10-15(21)3-4-16(13)17-6-8-19(2)7-5-14-11-20(14,19)18(12)17/h10,12,14,16-18H,3-9,11H2,1-2H3/t12?,14?,16-,17+,18+,19-,20?/m0/s1 |
| InChIKey | VPDUWSOFHUTOHT-JHPXEBOJSA-N |
| XLogP | 4.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |