C20H28O2 — CID 90850507
(1R,7R,10R,11R)-18-hydroxy-7,18-dimethylpentacyclo[8.8.0.02,4.02,7.011,16]octadec-15-en-14-one (PubChem CID 90850507) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is (1R,7R,10R,11R)-18-hydroxy-7,18-dimethylpentacyclo[8.8.0.02,4.02,7.011,16]octadec-15-en-14-one.
| Compound Name | (1R,7R,10R,11R)-18-hydroxy-7,18-dimethylpentacyclo[8.8.0.02,4.02,7.011,16]octadec-15-en-14-one |
|---|---|
| PubChem CID | 90850507 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (1R,7R,10R,11R)-18-hydroxy-7,18-dimethylpentacyclo[8.8.0.02,4.02,7.011,16]octadec-15-en-14-one |
| SMILES | CC1(O)CC2=CC(=O)CC[C@@H]2[C@H]2CC[C@]3(C)CCC4CC43[C@@H]21 |
| InChI | InChI=1S/C20H28O2/c1-18-7-5-13-11-20(13,18)17-16(6-8-18)15-4-3-14(21)9-12(15)10-19(17,2)22/h9,13,15-17,22H,3-8,10-11H2,1-2H3/t13?,15-,16+,17-,18-,19?,20?/m0/s1 |
| InChIKey | IMGAVMUQHLOFOG-PRLSUEEASA-N |
| XLogP | 3.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |