C20H26O2 — CID 70168593
(8R,9R,10R,13S)-7-ethenyl-17-hydroxy-13-methyl-2,6,7,8,9,10,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 70168593) has the molecular formula C20H26O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is (8R,9R,10R,13S)-7-ethenyl-17-hydroxy-13-methyl-2,6,7,8,9,10,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9R,10R,13S)-7-ethenyl-17-hydroxy-13-methyl-2,6,7,8,9,10,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 70168593 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | (8R,9R,10R,13S)-7-ethenyl-17-hydroxy-13-methyl-2,6,7,8,9,10,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C=CC1CC2=CC(=O)CC[C@@H]2[C@H]2CC[C@@]3(C)C(=CCC3O)[C@H]12 |
| InChI | InChI=1S/C20H26O2/c1-3-12-10-13-11-14(21)4-5-15(13)16-8-9-20(2)17(19(12)16)6-7-18(20)22/h3,6,11-12,15-16,18-19,22H,1,4-5,7-10H2,2H3/t12?,15-,16+,18?,19+,20-/m0/s1 |
| InChIKey | GMGCIRYYOQOUIP-IKHIBFAOSA-N |
| XLogP | 3.82 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|