C19H26O — CID 57269266
(8R,9S,10R,13R,14S)-7,13-dimethyl-2,6,7,8,9,10,11,12,14,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 57269266) has the molecular formula C19H26O and a molecular weight of 270.42 g/mol. Its IUPAC name is (8R,9S,10R,13R,14S)-7,13-dimethyl-2,6,7,8,9,10,11,12,14,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10R,13R,14S)-7,13-dimethyl-2,6,7,8,9,10,11,12,14,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 57269266 |
| Molecular Formula | C19H26O |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | (8R,9S,10R,13R,14S)-7,13-dimethyl-2,6,7,8,9,10,11,12,14,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC1CC2=CC(=O)CC[C@@H]2[C@H]2CC[C@]3(C)CC=C[C@H]3[C@H]12 |
| InChI | InChI=1S/C19H26O/c1-12-10-13-11-14(20)5-6-15(13)16-7-9-19(2)8-3-4-17(19)18(12)16/h3-4,11-12,15-18H,5-10H2,1-2H3/t12?,15-,16+,17-,18+,19-/m0/s1 |
| InChIKey | RNDYTXHXTMGJGL-VCYKWCIDSA-N |
| XLogP | 4.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|