C15H20O2Si — CID 10467804
(3aS,4aS)-1-trimethylsilyl-3,3a,4,4a,5,6-hexahydrocyclopenta[a]indene-2,7-dione (PubChem CID 10467804) has the molecular formula C15H20O2Si and a molecular weight of 260.41 g/mol. Its IUPAC name is (3aS,4aS)-1-trimethylsilyl-3,3a,4,4a,5,6-hexahydrocyclopenta[a]indene-2,7-dione.
| Compound Name | (3aS,4aS)-1-trimethylsilyl-3,3a,4,4a,5,6-hexahydrocyclopenta[a]indene-2,7-dione |
|---|---|
| PubChem CID | 10467804 |
| Molecular Formula | C15H20O2Si |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | (3aS,4aS)-1-trimethylsilyl-3,3a,4,4a,5,6-hexahydrocyclopenta[a]indene-2,7-dione |
| SMILES | C[Si](C)(C)C1=C2C3=CC(=O)CC[C@H]3C[C@H]2CC1=O |
| InChI | InChI=1S/C15H20O2Si/c1-18(2,3)15-13(17)7-10-6-9-4-5-11(16)8-12(9)14(10)15/h8-10H,4-7H2,1-3H3/t9-,10-/m0/s1 |
| InChIKey | LVNBPASEDUQLLZ-UWVGGRQHSA-N |
| XLogP | 3.06 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|