C16H18O2 — CID 102410357
1,4-dimethyl-3,5,6,6a,7,8-hexahydrobenzo[e]azulene-2,9-dione (PubChem CID 102410357) has the molecular formula C16H18O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is 1,4-dimethyl-3,5,6,6a,7,8-hexahydrobenzo[e]azulene-2,9-dione.
| Compound Name | 1,4-dimethyl-3,5,6,6a,7,8-hexahydrobenzo[e]azulene-2,9-dione |
|---|---|
| PubChem CID | 102410357 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 1,4-dimethyl-3,5,6,6a,7,8-hexahydrobenzo[e]azulene-2,9-dione |
| SMILES | CC1=C2CC(=O)C(C)=C2C2=CC(=O)CCC2CC1 |
| InChI | InChI=1S/C16H18O2/c1-9-3-4-11-5-6-12(17)7-14(11)16-10(2)15(18)8-13(9)16/h7,11H,3-6,8H2,1-2H3 |
| InChIKey | QZAWIRKCEUEGPN-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |