C21H26O2 — CID 18635360
(3aR)-4-ethynyl-11b-hydroxy-3a,6-dimethyl-1,2,3,4,5,9,10,10a,11,11a-decahydrocyclopenta[a]anthracen-8-one (PubChem CID 18635360) has the molecular formula C21H26O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is (3aR)-4-ethynyl-11b-hydroxy-3a,6-dimethyl-1,2,3,4,5,9,10,10a,11,11a-decahydrocyclopenta[a]anthracen-8-one.
| Compound Name | (3aR)-4-ethynyl-11b-hydroxy-3a,6-dimethyl-1,2,3,4,5,9,10,10a,11,11a-decahydrocyclopenta[a]anthracen-8-one |
|---|---|
| PubChem CID | 18635360 |
| Molecular Formula | C21H26O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | (3aR)-4-ethynyl-11b-hydroxy-3a,6-dimethyl-1,2,3,4,5,9,10,10a,11,11a-decahydrocyclopenta[a]anthracen-8-one |
| SMILES | C#CC1CC2=C(C)C3=CC(=O)CCC3CC2C2(O)CCC[C@]12C |
| InChI | InChI=1S/C21H26O2/c1-4-15-11-18-13(2)17-12-16(22)7-6-14(17)10-19(18)21(23)9-5-8-20(15,21)3/h1,12,14-15,19,23H,5-11H2,2-3H3/t14?,15?,19?,20-,21?/m1/s1 |
| InChIKey | QYMLIIVZDGWCND-WCGFTRPDSA-N |
| XLogP | 3.80 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|