C16H24O3Si — CID 10379595
2-propan-2-yl-7-trimethylsilyloxy-4a,5,8,8a-tetrahydronaphthalene-1,4-dione (PubChem CID 10379595) has the molecular formula C16H24O3Si and a molecular weight of 292.45 g/mol. Its IUPAC name is 2-propan-2-yl-7-trimethylsilyloxy-4a,5,8,8a-tetrahydronaphthalene-1,4-dione.
| Compound Name | 2-propan-2-yl-7-trimethylsilyloxy-4a,5,8,8a-tetrahydronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 10379595 |
| Molecular Formula | C16H24O3Si |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 2-propan-2-yl-7-trimethylsilyloxy-4a,5,8,8a-tetrahydronaphthalene-1,4-dione |
| SMILES | CC(C)C1=CC(=O)C2CC=C(O[Si](C)(C)C)CC2C1=O |
| InChI | InChI=1S/C16H24O3Si/c1-10(2)13-9-15(17)12-7-6-11(19-20(3,4)5)8-14(12)16(13)18/h6,9-10,12,14H,7-8H2,1-5H3 |
| InChIKey | IMRRVQCWRCPCBV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|