C17H28O3Si — CID 10403038
(E)-3-[(1R,2R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-oxo-2-prop-2-enylcyclopentyl]prop-2-enal (PubChem CID 10403038) has the molecular formula C17H28O3Si and a molecular weight of 308.49 g/mol. Its IUPAC name is (E)-3-[(1R,2R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-oxo-2-prop-2-enylcyclopentyl]prop-2-enal.
| Compound Name | (E)-3-[(1R,2R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-oxo-2-prop-2-enylcyclopentyl]prop-2-enal |
|---|---|
| PubChem CID | 10403038 |
| Molecular Formula | C17H28O3Si |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | (E)-3-[(1R,2R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-oxo-2-prop-2-enylcyclopentyl]prop-2-enal |
| SMILES | C=CC[C@H]1C(=O)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1/C=C/C=O |
| InChI | InChI=1S/C17H28O3Si/c1-7-9-13-14(10-8-11-18)16(12-15(13)19)20-21(5,6)17(2,3)4/h7-8,10-11,13-14,16H,1,9,12H2,2-6H3/b10-8+/t13-,14-,16-/m1/s1 |
| InChIKey | UJDMXESHPUTARF-JYZWNMQMSA-N |
| XLogP | 3.91 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|