C20H36O2Si — CID 25022823
(5R,6R,9R,10R)-6-methyl-9-propan-2-yl-10-triethylsilyloxyspiro[4.5]dec-7-en-4-one (PubChem CID 25022823) has the molecular formula C20H36O2Si and a molecular weight of 336.59 g/mol. Its IUPAC name is (5R,6R,9R,10R)-6-methyl-9-propan-2-yl-10-triethylsilyloxyspiro[4.5]dec-7-en-4-one.
| Compound Name | (5R,6R,9R,10R)-6-methyl-9-propan-2-yl-10-triethylsilyloxyspiro[4.5]dec-7-en-4-one |
|---|---|
| PubChem CID | 25022823 |
| Molecular Formula | C20H36O2Si |
| Molecular Weight | 336.59 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | (5R,6R,9R,10R)-6-methyl-9-propan-2-yl-10-triethylsilyloxyspiro[4.5]dec-7-en-4-one |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@H](C(C)C)C=C[C@@H](C)[C@]12CCCC2=O |
| InChI | InChI=1S/C20H36O2Si/c1-7-23(8-2,9-3)22-19-17(15(4)5)13-12-16(6)20(19)14-10-11-18(20)21/h12-13,15-17,19H,7-11,14H2,1-6H3/t16-,17+,19-,20+/m1/s1 |
| InChIKey | ARUAIFSFIFMFPV-BWPNAZKDSA-N |
| XLogP | 5.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.59 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|