C17H29BrO2Si — CID 102275966
(5R,6S,10R)-7-bromo-10-[tert-butyl(dimethyl)silyl]oxy-6-methylspiro[4.5]dec-7-en-4-one (PubChem CID 102275966) has the molecular formula C17H29BrO2Si and a molecular weight of 373.41 g/mol. Its IUPAC name is (5R,6S,10R)-7-bromo-10-[tert-butyl(dimethyl)silyl]oxy-6-methylspiro[4.5]dec-7-en-4-one.
| Compound Name | (5R,6S,10R)-7-bromo-10-[tert-butyl(dimethyl)silyl]oxy-6-methylspiro[4.5]dec-7-en-4-one |
|---|---|
| PubChem CID | 102275966 |
| Molecular Formula | C17H29BrO2Si |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | (5R,6S,10R)-7-bromo-10-[tert-butyl(dimethyl)silyl]oxy-6-methylspiro[4.5]dec-7-en-4-one |
| SMILES | C[C@@H]1C(Br)=CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@]12CCCC2=O |
| InChI | InChI=1S/C17H29BrO2Si/c1-12-13(18)9-10-15(17(12)11-7-8-14(17)19)20-21(5,6)16(2,3)4/h9,12,15H,7-8,10-11H2,1-6H3/t12-,15-,17+/m1/s1 |
| InChIKey | WFPMLXDFLQOXBK-VMGRFDJRSA-N |
| XLogP | 5.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|