C18H31BrO2Si — CID 146168418
trans-(2S,3S)-2-(2-bromoprop-2-enyl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-ethenylcyclohexan-1-one (PubChem CID 146168418) has the molecular formula C18H31BrO2Si and a molecular weight of 387.43 g/mol. Its IUPAC name is trans-(2S,3S)-2-(2-bromoprop-2-enyl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-ethenylcyclohexan-1-one.
| Compound Name | trans-(2S,3S)-2-(2-bromoprop-2-enyl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-ethenylcyclohexan-1-one |
|---|---|
| PubChem CID | 146168418 |
| Molecular Formula | C18H31BrO2Si |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | trans-(2S,3S)-2-(2-bromoprop-2-enyl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-ethenylcyclohexan-1-one |
| SMILES | C=C[C@@H]1CCCC(=O)[C@@]1(CO[Si](C)(C)C(C)(C)C)CC(=C)Br |
| InChI | InChI=1S/C18H31BrO2Si/c1-8-15-10-9-11-16(20)18(15,12-14(2)19)13-21-22(6,7)17(3,4)5/h8,15H,1-2,9-13H2,3-7H3/t15-,18-/m1/s1 |
| InChIKey | BBGWZKFXQHURIB-CRAIPNDOSA-N |
| XLogP | 5.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|