C20H36O3Si — CID 44516375
2-[(E,2S,3R)-2-propan-2-yl-3-triethylsilyloxyhex-4-enoyl]cyclopentan-1-one (PubChem CID 44516375) has the molecular formula C20H36O3Si and a molecular weight of 352.59 g/mol. Its IUPAC name is 2-[(E,2S,3R)-2-propan-2-yl-3-triethylsilyloxyhex-4-enoyl]cyclopentan-1-one.
| Compound Name | 2-[(E,2S,3R)-2-propan-2-yl-3-triethylsilyloxyhex-4-enoyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 44516375 |
| Molecular Formula | C20H36O3Si |
| Molecular Weight | 352.59 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | 2-[(E,2S,3R)-2-propan-2-yl-3-triethylsilyloxyhex-4-enoyl]cyclopentan-1-one |
| SMILES | C/C=C/[C@@H](O[Si](CC)(CC)CC)[C@@H](C(=O)C1CCCC1=O)C(C)C |
| InChI | InChI=1S/C20H36O3Si/c1-7-12-18(23-24(8-2,9-3)10-4)19(15(5)6)20(22)16-13-11-14-17(16)21/h7,12,15-16,18-19H,8-11,13-14H2,1-6H3/b12-7+/t16?,18-,19+/m1/s1 |
| InChIKey | QKKWROVXGDQTTA-YDVLPXMYSA-N |
| XLogP | 5.16 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.59 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|