C26H48O2Si — CID 134834299
(2S,3R,6S)-2-[(1R,2E)-1-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethylocta-2,7-dienyl]-6-methyl-3-propan-2-ylcyclohexan-1-one (PubChem CID 134834299) has the molecular formula C26H48O2Si and a molecular weight of 420.75 g/mol. Its IUPAC name is (2S,3R,6S)-2-[(1R,2E)-1-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethylocta-2,7-dienyl]-6-methyl-3-propan-2-ylcyclohexan-1-one.
| Compound Name | (2S,3R,6S)-2-[(1R,2E)-1-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethylocta-2,7-dienyl]-6-methyl-3-propan-2-ylcyclohexan-1-one |
|---|---|
| PubChem CID | 134834299 |
| Molecular Formula | C26H48O2Si |
| Molecular Weight | 420.75 g/mol |
| Exact Mass | 420.34 |
| IUPAC Name | (2S,3R,6S)-2-[(1R,2E)-1-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethylocta-2,7-dienyl]-6-methyl-3-propan-2-ylcyclohexan-1-one |
| SMILES | C=CC(C)CC/C=C(\C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)[C@@H](C)CC[C@@H]1C(C)C |
| InChI | InChI=1S/C26H48O2Si/c1-12-19(4)14-13-15-21(6)25(28-29(10,11)26(7,8)9)23-22(18(2)3)17-16-20(5)24(23)27/h12,15,18-20,22-23,25H,1,13-14,16-17H2,2-11H3/b21-15+/t19?,20-,22+,23+,25-/m0/s1 |
| InChIKey | RKUFYSCUZJGWOM-RMUMHNFXSA-N |
| XLogP | 7.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.75 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|