C26H48O3Si — CID 102160302
(2S,3R,6S)-2-[(1R,2E,6E)-1-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-2,6-dimethylocta-2,6-dienyl]-6-methyl-3-propan-2-ylcyclohexan-1-one (PubChem CID 102160302) has the molecular formula C26H48O3Si and a molecular weight of 436.75 g/mol. Its IUPAC name is (2S,3R,6S)-2-[(1R,2E,6E)-1-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-2,6-dimethylocta-2,6-dienyl]-6-methyl-3-propan-2-ylcyclohexan-1-one.
| Compound Name | (2S,3R,6S)-2-[(1R,2E,6E)-1-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-2,6-dimethylocta-2,6-dienyl]-6-methyl-3-propan-2-ylcyclohexan-1-one |
|---|---|
| PubChem CID | 102160302 |
| Molecular Formula | C26H48O3Si |
| Molecular Weight | 436.75 g/mol |
| Exact Mass | 436.34 |
| IUPAC Name | (2S,3R,6S)-2-[(1R,2E,6E)-1-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-2,6-dimethylocta-2,6-dienyl]-6-methyl-3-propan-2-ylcyclohexan-1-one |
| SMILES | C/C(=C\CO)CC/C=C(\C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)[C@@H](C)CC[C@@H]1C(C)C |
| InChI | InChI=1S/C26H48O3Si/c1-18(2)22-15-14-20(4)24(28)23(22)25(29-30(9,10)26(6,7)8)21(5)13-11-12-19(3)16-17-27/h13,16,18,20,22-23,25,27H,11-12,14-15,17H2,1-10H3/b19-16+,21-13+/t20-,22+,23+,25-/m0/s1 |
| InChIKey | NQINRXJONHUAPE-ZKOBHARESA-N |
| XLogP | 6.93 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.75 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|