C26H46O2Si — CID 137284936
(1R,3E,7E,9R,10S,12R)-9-[tert-butyl(dimethyl)silyl]oxy-4,8,12-trimethyl-14-propan-2-ylbicyclo[8.2.2]tetradeca-3,7-dien-11-one (PubChem CID 137284936) has the molecular formula C26H46O2Si and a molecular weight of 418.74 g/mol. Its IUPAC name is (1R,3E,7E,9R,10S,12R)-9-[tert-butyl(dimethyl)silyl]oxy-4,8,12-trimethyl-14-propan-2-ylbicyclo[8.2.2]tetradeca-3,7-dien-11-one.
| Compound Name | (1R,3E,7E,9R,10S,12R)-9-[tert-butyl(dimethyl)silyl]oxy-4,8,12-trimethyl-14-propan-2-ylbicyclo[8.2.2]tetradeca-3,7-dien-11-one |
|---|---|
| PubChem CID | 137284936 |
| Molecular Formula | C26H46O2Si |
| Molecular Weight | 418.74 g/mol |
| Exact Mass | 418.33 |
| IUPAC Name | (1R,3E,7E,9R,10S,12R)-9-[tert-butyl(dimethyl)silyl]oxy-4,8,12-trimethyl-14-propan-2-ylbicyclo[8.2.2]tetradeca-3,7-dien-11-one |
| SMILES | C/C1=C/C[C@H]2CC(C(C)C)[C@H](C(=O)[C@@H]2C)[C@@H](O[Si](C)(C)C(C)(C)C)/C(C)=C\CC1 |
| InChI | InChI=1S/C26H46O2Si/c1-17(2)22-16-21-15-14-18(3)12-11-13-19(4)25(23(22)24(27)20(21)5)28-29(9,10)26(6,7)8/h13-14,17,20-23,25H,11-12,15-16H2,1-10H3/b18-14-,19-13-/t20-,21+,22?,23-,25+/m1/s1 |
| InChIKey | SWWPZEYEJSEAEV-PURWPZPVSA-N |
| XLogP | 7.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.74 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|