C25H48O2Si — CID 15071506
3-[(E)-2-methyl-6-tri(propan-2-yl)silyloxyhex-1-enyl]-4-propan-2-ylcyclohexan-1-one (PubChem CID 15071506) has the molecular formula C25H48O2Si and a molecular weight of 408.74 g/mol. Its IUPAC name is 3-[(E)-2-methyl-6-tri(propan-2-yl)silyloxyhex-1-enyl]-4-propan-2-ylcyclohexan-1-one.
| Compound Name | 3-[(E)-2-methyl-6-tri(propan-2-yl)silyloxyhex-1-enyl]-4-propan-2-ylcyclohexan-1-one |
|---|---|
| PubChem CID | 15071506 |
| Molecular Formula | C25H48O2Si |
| Molecular Weight | 408.74 g/mol |
| Exact Mass | 408.34 |
| IUPAC Name | 3-[(E)-2-methyl-6-tri(propan-2-yl)silyloxyhex-1-enyl]-4-propan-2-ylcyclohexan-1-one |
| SMILES | C/C(=C\C1CC(=O)CCC1C(C)C)CCCCO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H48O2Si/c1-18(2)25-14-13-24(26)17-23(25)16-22(9)12-10-11-15-27-28(19(3)4,20(5)6)21(7)8/h16,18-21,23,25H,10-15,17H2,1-9H3/b22-16+ |
| InChIKey | XGOSUUFNNMSPEF-CJLVFECKSA-N |
| XLogP | 7.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.74 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|