C30H57O6PSi — CID 102160304
[(2E,6E,8R)-8-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyl-8-[(1S,3S,6R)-3-methyl-2-oxo-6-propan-2-ylcyclohexyl]octa-2,6-dienyl] diethyl phosphate (PubChem CID 102160304) has the molecular formula C30H57O6PSi and a molecular weight of 572.84 g/mol. Its IUPAC name is [(2E,6E,8R)-8-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyl-8-[(1S,3S,6R)-3-methyl-2-oxo-6-propan-2-ylcyclohexyl]octa-2,6-dienyl] diethyl phosphate.
| Compound Name | [(2E,6E,8R)-8-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyl-8-[(1S,3S,6R)-3-methyl-2-oxo-6-propan-2-ylcyclohexyl]octa-2,6-dienyl] diethyl phosphate |
|---|---|
| PubChem CID | 102160304 |
| Molecular Formula | C30H57O6PSi |
| Molecular Weight | 572.84 g/mol |
| Exact Mass | 572.37 |
| IUPAC Name | [(2E,6E,8R)-8-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyl-8-[(1S,3S,6R)-3-methyl-2-oxo-6-propan-2-ylcyclohexyl]octa-2,6-dienyl] diethyl phosphate |
| SMILES | CCOP(=O)(OCC)OC/C=C(\C)CC/C=C(\C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)[C@@H](C)CC[C@@H]1C(C)C |
| InChI | InChI=1S/C30H57O6PSi/c1-13-33-37(32,34-14-2)35-21-20-23(5)16-15-17-25(7)29(36-38(11,12)30(8,9)10)27-26(22(3)4)19-18-24(6)28(27)31/h17,20,22,24,26-27,29H,13-16,18-19,21H2,1-12H3/b23-20+,25-17+/t24-,26+,27+,29-/m0/s1 |
| InChIKey | BMXNTFAYHKEGOF-NNXZVBJLSA-N |
| XLogP | 9.13 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.84 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|