C22H40O3Si — CID 25112425
(3aR,4R,6S,9E,12aR)-4-hydroxy-6,12a-dimethyl-8-triethylsilyloxy-1,2,3a,4,5,6,7,8,11,12-decahydrocyclopenta[11]annulen-3-one (PubChem CID 25112425) has the molecular formula C22H40O3Si and a molecular weight of 380.65 g/mol. Its IUPAC name is (3aR,4R,6S,9E,12aR)-4-hydroxy-6,12a-dimethyl-8-triethylsilyloxy-1,2,3a,4,5,6,7,8,11,12-decahydrocyclopenta[11]annulen-3-one.
| Compound Name | (3aR,4R,6S,9E,12aR)-4-hydroxy-6,12a-dimethyl-8-triethylsilyloxy-1,2,3a,4,5,6,7,8,11,12-decahydrocyclopenta[11]annulen-3-one |
|---|---|
| PubChem CID | 25112425 |
| Molecular Formula | C22H40O3Si |
| Molecular Weight | 380.65 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | (3aR,4R,6S,9E,12aR)-4-hydroxy-6,12a-dimethyl-8-triethylsilyloxy-1,2,3a,4,5,6,7,8,11,12-decahydrocyclopenta[11]annulen-3-one |
| SMILES | CC[Si](CC)(CC)OC1/C=C/CC[C@]2(C)CCC(=O)[C@H]2[C@H](O)C[C@H](C)C1 |
| InChI | InChI=1S/C22H40O3Si/c1-6-26(7-2,8-3)25-18-11-9-10-13-22(5)14-12-19(23)21(22)20(24)16-17(4)15-18/h9,11,17-18,20-21,24H,6-8,10,12-16H2,1-5H3/b11-9+/t17-,18?,20-,21+,22-/m1/s1 |
| InChIKey | STBXFELSXPQHOA-KNQPXKLPSA-N |
| XLogP | 5.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.65 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|