C21H40O3Si — CID 134864287
cis-(2S,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[(E)-7-hydroxy-4-methylhept-3-enyl]-2-methylcyclopentan-1-one (PubChem CID 134864287) has the molecular formula C21H40O3Si and a molecular weight of 368.63 g/mol. Its IUPAC name is cis-(2S,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[(E)-7-hydroxy-4-methylhept-3-enyl]-2-methylcyclopentan-1-one.
| Compound Name | cis-(2S,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[(E)-7-hydroxy-4-methylhept-3-enyl]-2-methylcyclopentan-1-one |
|---|---|
| PubChem CID | 134864287 |
| Molecular Formula | C21H40O3Si |
| Molecular Weight | 368.63 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | cis-(2S,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[(E)-7-hydroxy-4-methylhept-3-enyl]-2-methylcyclopentan-1-one |
| SMILES | C/C(=C\CC[C@]1(C)C(=O)CC[C@H]1CO[Si](C)(C)C(C)(C)C)CCCO |
| InChI | InChI=1S/C21H40O3Si/c1-17(11-9-15-22)10-8-14-21(5)18(12-13-19(21)23)16-24-25(6,7)20(2,3)4/h10,18,22H,8-9,11-16H2,1-7H3/b17-10+/t18-,21-/m0/s1 |
| InChIKey | GWUXPFYDUFXMDT-KIPHSXGHSA-N |
| XLogP | 5.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.63 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|