C20H34O3Si — CID 10948108
(3aR,7S,7aS)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-hydroxy-5,7-dimethylspiro[3,7a-dihydro-2H-indene-6,1'-cyclopropane]-1-one (PubChem CID 10948108) has the molecular formula C20H34O3Si and a molecular weight of 350.58 g/mol. Its IUPAC name is (3aR,7S,7aS)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-hydroxy-5,7-dimethylspiro[3,7a-dihydro-2H-indene-6,1'-cyclopropane]-1-one.
| Compound Name | (3aR,7S,7aS)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-hydroxy-5,7-dimethylspiro[3,7a-dihydro-2H-indene-6,1'-cyclopropane]-1-one |
|---|---|
| PubChem CID | 10948108 |
| Molecular Formula | C20H34O3Si |
| Molecular Weight | 350.58 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | (3aR,7S,7aS)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-hydroxy-5,7-dimethylspiro[3,7a-dihydro-2H-indene-6,1'-cyclopropane]-1-one |
| SMILES | CC1=C[C@]2(CO[Si](C)(C)C(C)(C)C)CCC(=O)[C@@H]2[C@](C)(O)C12CC2 |
| InChI | InChI=1S/C20H34O3Si/c1-14-12-19(13-23-24(6,7)17(2,3)4)9-8-15(21)16(19)18(5,22)20(14)10-11-20/h12,16,22H,8-11,13H2,1-7H3/t16-,18+,19+/m1/s1 |
| InChIKey | OCJSGGLFNMUWFY-NEWSRXKRSA-N |
| XLogP | 4.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.58 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|