C24H44O3Si2 — CID 11732854
(2R,3aR,7S,7aS)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,5,7-trimethyl-7-trimethylsilyloxyspiro[3,7a-dihydro-2H-indene-6,1'-cyclopropane]-1-one (PubChem CID 11732854) has the molecular formula C24H44O3Si2 and a molecular weight of 436.79 g/mol. Its IUPAC name is (2R,3aR,7S,7aS)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,5,7-trimethyl-7-trimethylsilyloxyspiro[3,7a-dihydro-2H-indene-6,1'-cyclopropane]-1-one.
| Compound Name | (2R,3aR,7S,7aS)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,5,7-trimethyl-7-trimethylsilyloxyspiro[3,7a-dihydro-2H-indene-6,1'-cyclopropane]-1-one |
|---|---|
| PubChem CID | 11732854 |
| Molecular Formula | C24H44O3Si2 |
| Molecular Weight | 436.79 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | (2R,3aR,7S,7aS)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,5,7-trimethyl-7-trimethylsilyloxyspiro[3,7a-dihydro-2H-indene-6,1'-cyclopropane]-1-one |
| SMILES | CC1=C[C@]2(CO[Si](C)(C)C(C)(C)C)C[C@@H](C)C(=O)[C@@H]2[C@](C)(O[Si](C)(C)C)C12CC2 |
| InChI | InChI=1S/C24H44O3Si2/c1-17-14-23(16-26-29(10,11)21(3,4)5)15-18(2)24(12-13-24)22(6,20(23)19(17)25)27-28(7,8)9/h15,17,20H,12-14,16H2,1-11H3/t17-,20-,22+,23+/m1/s1 |
| InChIKey | LSCMCRBCJYUXFM-QRRACGJLSA-N |
| XLogP | 6.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.79 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|