C26H44O2Si — CID 162418274
(1R,2R,4R,5R,9S,10R,12R,14S)-4,7,11,11,14-pentamethyl-2-triethylsilyloxytetracyclo[7.6.0.01,5.010,12]pentadec-6-en-15-one (PubChem CID 162418274) has the molecular formula C26H44O2Si and a molecular weight of 416.72 g/mol. Its IUPAC name is (1R,2R,4R,5R,9S,10R,12R,14S)-4,7,11,11,14-pentamethyl-2-triethylsilyloxytetracyclo[7.6.0.01,5.010,12]pentadec-6-en-15-one.
| Compound Name | (1R,2R,4R,5R,9S,10R,12R,14S)-4,7,11,11,14-pentamethyl-2-triethylsilyloxytetracyclo[7.6.0.01,5.010,12]pentadec-6-en-15-one |
|---|---|
| PubChem CID | 162418274 |
| Molecular Formula | C26H44O2Si |
| Molecular Weight | 416.72 g/mol |
| Exact Mass | 416.31 |
| IUPAC Name | (1R,2R,4R,5R,9S,10R,12R,14S)-4,7,11,11,14-pentamethyl-2-triethylsilyloxytetracyclo[7.6.0.01,5.010,12]pentadec-6-en-15-one |
| SMILES | CC[Si](CC)(CC)O[C@@H]1C[C@@H](C)[C@@H]2C=C(C)C[C@H]3[C@H]4[C@@H](C[C@H](C)C(=O)[C@@]123)C4(C)C |
| InChI | InChI=1S/C26H44O2Si/c1-9-29(10-2,11-3)28-22-15-17(5)19-12-16(4)13-21-23-20(25(23,7)8)14-18(6)24(27)26(19,21)22/h12,17-23H,9-11,13-15H2,1-8H3/t17-,18+,19+,20-,21+,22-,23-,26+/m1/s1 |
| InChIKey | YOSJXZGQYVXZBC-GEBGFRFRSA-N |
| XLogP | 6.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.72 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|