C22H40O2Si — CID 10361443
(1R,5R,6R,8S)-5-[tert-butyl(dimethyl)silyl]oxy-1,8,9,9-tetramethyl-8-prop-2-enylbicyclo[4.2.1]nonan-7-one (PubChem CID 10361443) has the molecular formula C22H40O2Si and a molecular weight of 364.65 g/mol. Its IUPAC name is (1R,5R,6R,8S)-5-[tert-butyl(dimethyl)silyl]oxy-1,8,9,9-tetramethyl-8-prop-2-enylbicyclo[4.2.1]nonan-7-one.
| Compound Name | (1R,5R,6R,8S)-5-[tert-butyl(dimethyl)silyl]oxy-1,8,9,9-tetramethyl-8-prop-2-enylbicyclo[4.2.1]nonan-7-one |
|---|---|
| PubChem CID | 10361443 |
| Molecular Formula | C22H40O2Si |
| Molecular Weight | 364.65 g/mol |
| Exact Mass | 364.28 |
| IUPAC Name | (1R,5R,6R,8S)-5-[tert-butyl(dimethyl)silyl]oxy-1,8,9,9-tetramethyl-8-prop-2-enylbicyclo[4.2.1]nonan-7-one |
| SMILES | C=CC[C@]1(C)C(=O)[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)CCC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C22H40O2Si/c1-11-14-21(7)18(23)17-16(24-25(9,10)19(2,3)4)13-12-15-22(21,8)20(17,5)6/h11,16-17H,1,12-15H2,2-10H3/t16-,17-,21-,22-/m1/s1 |
| InChIKey | YCUVJFAWCWDDGB-XWOARTFESA-N |
| XLogP | 6.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.65 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|