C18H34O2Si — CID 174136939
cis-(2S,3S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-methyl-2-prop-2-enylcyclopentan-1-one (PubChem CID 174136939) has the molecular formula C18H34O2Si and a molecular weight of 310.55 g/mol. Its IUPAC name is cis-(2S,3S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-methyl-2-prop-2-enylcyclopentan-1-one.
| Compound Name | cis-(2S,3S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-methyl-2-prop-2-enylcyclopentan-1-one |
|---|---|
| PubChem CID | 174136939 |
| Molecular Formula | C18H34O2Si |
| Molecular Weight | 310.55 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | cis-(2S,3S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-methyl-2-prop-2-enylcyclopentan-1-one |
| SMILES | C=CC[C@]1(CCCO[Si](C)(C)C(C)(C)C)C(=O)CC[C@@H]1C |
| InChI | InChI=1S/C18H34O2Si/c1-8-12-18(15(2)10-11-16(18)19)13-9-14-20-21(6,7)17(3,4)5/h8,15H,1,9-14H2,2-7H3/t15-,18+/m0/s1 |
| InChIKey | MCWNYWTUMLIHHZ-MAUKXSAKSA-N |
| XLogP | 5.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.55 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|