C20H40O2Si — CID 155933850
5-ethenyl-2-methyl-8-tri(propan-2-yl)silyloxyoctan-4-one (PubChem CID 155933850) has the molecular formula C20H40O2Si and a molecular weight of 340.62 g/mol. Its IUPAC name is 5-ethenyl-2-methyl-8-tri(propan-2-yl)silyloxyoctan-4-one.
| Compound Name | 5-ethenyl-2-methyl-8-tri(propan-2-yl)silyloxyoctan-4-one |
|---|---|
| PubChem CID | 155933850 |
| Molecular Formula | C20H40O2Si |
| Molecular Weight | 340.62 g/mol |
| Exact Mass | 340.28 |
| IUPAC Name | 5-ethenyl-2-methyl-8-tri(propan-2-yl)silyloxyoctan-4-one |
| SMILES | C=CC(CCCO[Si](C(C)C)(C(C)C)C(C)C)C(=O)CC(C)C |
| InChI | InChI=1S/C20H40O2Si/c1-10-19(20(21)14-15(2)3)12-11-13-22-23(16(4)5,17(6)7)18(8)9/h10,15-19H,1,11-14H2,2-9H3 |
| InChIKey | DIAGPPJGIYBLCE-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.62 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|