C21H36O2Si — CID 167311407
(1S,5S)-1-ethenyl-2,2,9-trimethyl-8-triethylsilyloxyspiro[4.5]dec-8-en-4-one (PubChem CID 167311407) has the molecular formula C21H36O2Si and a molecular weight of 348.60 g/mol. Its IUPAC name is (1S,5S)-1-ethenyl-2,2,9-trimethyl-8-triethylsilyloxyspiro[4.5]dec-8-en-4-one.
| Compound Name | (1S,5S)-1-ethenyl-2,2,9-trimethyl-8-triethylsilyloxyspiro[4.5]dec-8-en-4-one |
|---|---|
| PubChem CID | 167311407 |
| Molecular Formula | C21H36O2Si |
| Molecular Weight | 348.60 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | (1S,5S)-1-ethenyl-2,2,9-trimethyl-8-triethylsilyloxyspiro[4.5]dec-8-en-4-one |
| SMILES | C=C[C@H]1C(C)(C)CC(=O)[C@]12CCC(O[Si](CC)(CC)CC)=C(C)C2 |
| InChI | InChI=1S/C21H36O2Si/c1-8-18-20(6,7)15-19(22)21(18)13-12-17(16(5)14-21)23-24(9-2,10-3)11-4/h8,18H,1,9-15H2,2-7H3/t18-,21-/m0/s1 |
| InChIKey | IRRKKDQBWGIJHX-RXVVDRJESA-N |
| XLogP | 6.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.60 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|