C24H36O2Si — CID 134836275
(3R,11S,12R)-5-[tert-butyl(dimethyl)silyl]oxypentacyclo[13.2.1.02,14.03,12.06,11]octadeca-5,16-dien-13-one (PubChem CID 134836275) has the molecular formula C24H36O2Si and a molecular weight of 384.64 g/mol. Its IUPAC name is (3R,11S,12R)-5-[tert-butyl(dimethyl)silyl]oxypentacyclo[13.2.1.02,14.03,12.06,11]octadeca-5,16-dien-13-one.
| Compound Name | (3R,11S,12R)-5-[tert-butyl(dimethyl)silyl]oxypentacyclo[13.2.1.02,14.03,12.06,11]octadeca-5,16-dien-13-one |
|---|---|
| PubChem CID | 134836275 |
| Molecular Formula | C24H36O2Si |
| Molecular Weight | 384.64 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | (3R,11S,12R)-5-[tert-butyl(dimethyl)silyl]oxypentacyclo[13.2.1.02,14.03,12.06,11]octadeca-5,16-dien-13-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1=C2CCCC[C@H]2[C@@H]2C(=O)C3C4C=CC(C4)C3[C@H]2C1 |
| InChI | InChI=1S/C24H36O2Si/c1-24(2,3)27(4,5)26-19-13-18-20-14-10-11-15(12-14)21(20)23(25)22(18)17-9-7-6-8-16(17)19/h10-11,14-15,17-18,20-22H,6-9,12-13H2,1-5H3/t14?,15?,17-,18-,20?,21?,22+/m1/s1 |
| InChIKey | TVANOGOZKDZRJW-NNBPLUHTSA-N |
| XLogP | 6.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.64 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|