C21H36O2Si — CID 10783961
(1S,2R,6S,7R)-4-[5-[tert-butyl(dimethyl)silyl]oxypentyl]tricyclo[5.2.1.02,6]dec-8-en-3-one (PubChem CID 10783961) has the molecular formula C21H36O2Si and a molecular weight of 348.60 g/mol. Its IUPAC name is (1S,2R,6S,7R)-4-[5-[tert-butyl(dimethyl)silyl]oxypentyl]tricyclo[5.2.1.02,6]dec-8-en-3-one.
| Compound Name | (1S,2R,6S,7R)-4-[5-[tert-butyl(dimethyl)silyl]oxypentyl]tricyclo[5.2.1.02,6]dec-8-en-3-one |
|---|---|
| PubChem CID | 10783961 |
| Molecular Formula | C21H36O2Si |
| Molecular Weight | 348.60 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | (1S,2R,6S,7R)-4-[5-[tert-butyl(dimethyl)silyl]oxypentyl]tricyclo[5.2.1.02,6]dec-8-en-3-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCCC1C[C@@H]2[C@H](C1=O)[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C21H36O2Si/c1-21(2,3)24(4,5)23-12-8-6-7-9-17-14-18-15-10-11-16(13-15)19(18)20(17)22/h10-11,15-19H,6-9,12-14H2,1-5H3/t15-,16+,17?,18-,19+/m0/s1 |
| InChIKey | WYUWSRGEBOGMER-JKHFOPOESA-N |
| XLogP | 5.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.60 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|