C23H44FO2Si+ — CID 90908220
[4-fluoro-1-[(1S)-2-[(Z)-hept-2-enyl]-5-methyl-3-oxocyclopentyl]octan-3-yl]oxy-dimethylsilanylium (PubChem CID 90908220) has the molecular formula C23H44FO2Si+ and a molecular weight of 399.69 g/mol. Its IUPAC name is [4-fluoro-1-[(1S)-2-[(Z)-hept-2-enyl]-5-methyl-3-oxocyclopentyl]octan-3-yl]oxy-dimethylsilanylium.
| Compound Name | [4-fluoro-1-[(1S)-2-[(Z)-hept-2-enyl]-5-methyl-3-oxocyclopentyl]octan-3-yl]oxy-dimethylsilanylium |
|---|---|
| PubChem CID | 90908220 |
| Molecular Formula | C23H44FO2Si+ |
| Molecular Weight | 399.69 g/mol |
| Exact Mass | 399.31 |
| IUPAC Name | [4-fluoro-1-[(1S)-2-[(Z)-hept-2-enyl]-5-methyl-3-oxocyclopentyl]octan-3-yl]oxy-dimethylsilanylium |
| SMILES | CCCC/C=C\CC1C(=O)CC(C)[C@@H]1CCC(O[SiH2+](C)C)C(F)CCCC |
| InChI | InChI=1S/C23H44FO2Si/c1-6-8-10-11-12-13-20-19(18(3)17-22(20)25)15-16-23(26-27(4)5)21(24)14-9-7-2/h11-12,18-21,23H,6-10,13-17,27H2,1-5H3/q+1/b12-11-/t18?,19-,20?,21?,23?/m0/s1 |
| InChIKey | REIZQPNNQKOLTQ-JOQNFZOASA-N |
| XLogP | 6.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.69 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|