C27H48O2Si — CID 57200192
(2R)-3-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyloctyl]-2-hepta-3,4-dienylcyclopent-3-en-1-one (PubChem CID 57200192) has the molecular formula C27H48O2Si and a molecular weight of 432.77 g/mol. Its IUPAC name is (2R)-3-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyloctyl]-2-hepta-3,4-dienylcyclopent-3-en-1-one.
| Compound Name | (2R)-3-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyloctyl]-2-hepta-3,4-dienylcyclopent-3-en-1-one |
|---|---|
| PubChem CID | 57200192 |
| Molecular Formula | C27H48O2Si |
| Molecular Weight | 432.77 g/mol |
| Exact Mass | 432.34 |
| IUPAC Name | (2R)-3-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyloctyl]-2-hepta-3,4-dienylcyclopent-3-en-1-one |
| SMILES | CCC=C=CCC[C@H]1C(=O)CC=C1CC[C@H](O[Si](C)(C)C(C)(C)C)C(C)CCCC |
| InChI | InChI=1S/C27H48O2Si/c1-9-11-13-14-15-17-24-23(18-20-25(24)28)19-21-26(22(3)16-12-10-2)29-30(7,8)27(4,5)6/h11,14,18,22,24,26H,9-10,12,15-17,19-21H2,1-8H3/t13?,22?,24-,26+/m1/s1 |
| InChIKey | GWIXXHZMRYWUGD-UKIKRDKKSA-N |
| XLogP | 8.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.77 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|