C19H38O2Si — CID 11313407
(5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,9-dimethyldec-8-en-2-one (PubChem CID 11313407) has the molecular formula C19H38O2Si and a molecular weight of 326.60 g/mol. Its IUPAC name is (5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,9-dimethyldec-8-en-2-one.
| Compound Name | (5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,9-dimethyldec-8-en-2-one |
|---|---|
| PubChem CID | 11313407 |
| Molecular Formula | C19H38O2Si |
| Molecular Weight | 326.60 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | (5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,9-dimethyldec-8-en-2-one |
| SMILES | CC(=O)CC[C@@](C)(CCC=C(C)C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H38O2Si/c1-16(2)11-10-13-19(7,14-12-17(3)20)15-21-22(8,9)18(4,5)6/h11H,10,12-15H2,1-9H3/t19-/m1/s1 |
| InChIKey | AHTQVJBKOMFGLV-LJQANCHMSA-N |
| XLogP | 6.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.60 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|