C21H42O2Si — CID 164683021
(E,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methyltridec-7-en-2-one (PubChem CID 164683021) has the molecular formula C21H42O2Si and a molecular weight of 354.65 g/mol. Its IUPAC name is (E,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methyltridec-7-en-2-one.
| Compound Name | (E,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methyltridec-7-en-2-one |
|---|---|
| PubChem CID | 164683021 |
| Molecular Formula | C21H42O2Si |
| Molecular Weight | 354.65 g/mol |
| Exact Mass | 354.30 |
| IUPAC Name | (E,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methyltridec-7-en-2-one |
| SMILES | CCCCC/C=C/[C@](C)(CCCC(C)=O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H42O2Si/c1-9-10-11-12-13-16-21(6,17-14-15-19(2)22)18-23-24(7,8)20(3,4)5/h13,16H,9-12,14-15,17-18H2,1-8H3/b16-13+/t21-/m1/s1 |
| InChIKey | VYKCTPIKNQVXQD-RDOKFVIMSA-N |
| XLogP | 6.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.65 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|