C20H36O2Si — CID 162786833
4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-(3-methylbut-2-enyl)cyclohex-2-en-1-one (PubChem CID 162786833) has the molecular formula C20H36O2Si and a molecular weight of 336.59 g/mol. Its IUPAC name is 4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-(3-methylbut-2-enyl)cyclohex-2-en-1-one.
| Compound Name | 4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-(3-methylbut-2-enyl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 162786833 |
| Molecular Formula | C20H36O2Si |
| Molecular Weight | 336.59 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | 4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-(3-methylbut-2-enyl)cyclohex-2-en-1-one |
| SMILES | CC(C)=CCC1(CCCO[Si](C)(C)C(C)(C)C)C=CC(=O)CC1 |
| InChI | InChI=1S/C20H36O2Si/c1-17(2)9-13-20(14-10-18(21)11-15-20)12-8-16-22-23(6,7)19(3,4)5/h9-10,14H,8,11-13,15-16H2,1-7H3 |
| InChIKey | QNIGSOLZPHMYHV-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.59 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|