C24H40O2Si — CID 135086555
(1S,3E,7E,11R)-13-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethylbicyclo[9.4.0]pentadeca-3,7,13-triene-1-carbaldehyde (PubChem CID 135086555) has the molecular formula C24H40O2Si and a molecular weight of 388.67 g/mol. Its IUPAC name is (1S,3E,7E,11R)-13-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethylbicyclo[9.4.0]pentadeca-3,7,13-triene-1-carbaldehyde.
| Compound Name | (1S,3E,7E,11R)-13-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethylbicyclo[9.4.0]pentadeca-3,7,13-triene-1-carbaldehyde |
|---|---|
| PubChem CID | 135086555 |
| Molecular Formula | C24H40O2Si |
| Molecular Weight | 388.67 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | (1S,3E,7E,11R)-13-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethylbicyclo[9.4.0]pentadeca-3,7,13-triene-1-carbaldehyde |
| SMILES | C/C1=C\C[C@]2(C=O)CC=C(O[Si](C)(C)C(C)(C)C)C[C@H]2CC/C(C)=C/CC1 |
| InChI | InChI=1S/C24H40O2Si/c1-19-9-8-10-20(2)13-15-24(18-25)16-14-22(17-21(24)12-11-19)26-27(6,7)23(3,4)5/h9,13-14,18,21H,8,10-12,15-17H2,1-7H3/b19-9+,20-13+/t21-,24-/m1/s1 |
| InChIKey | USQFOOGTTJDALD-UOMXEPHNSA-N |
| XLogP | 7.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.67 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|