C18H34O2Si — CID 552393
3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2,4-trimethylcyclohex-3-ene-1-carbaldehyde (PubChem CID 552393) has the molecular formula C18H34O2Si and a molecular weight of 310.55 g/mol. Its IUPAC name is 3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2,4-trimethylcyclohex-3-ene-1-carbaldehyde.
| Compound Name | 3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2,4-trimethylcyclohex-3-ene-1-carbaldehyde |
|---|---|
| PubChem CID | 552393 |
| Molecular Formula | C18H34O2Si |
| Molecular Weight | 310.55 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | 3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2,4-trimethylcyclohex-3-ene-1-carbaldehyde |
| SMILES | CC1=C(CCO[Si](C)(C)C(C)(C)C)C(C)(C)C(C=O)CC1 |
| InChI | InChI=1S/C18H34O2Si/c1-14-9-10-15(13-19)18(5,6)16(14)11-12-20-21(7,8)17(2,3)4/h13,15H,9-12H2,1-8H3 |
| InChIKey | IEKXFIXOYJYNNY-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.55 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|