C17H32O2Si — CID 10913494
1-methyl-4-tri(propan-2-yl)silyloxycyclohex-3-ene-1-carbaldehyde (PubChem CID 10913494) has the molecular formula C17H32O2Si and a molecular weight of 296.53 g/mol. Its IUPAC name is 1-methyl-4-tri(propan-2-yl)silyloxycyclohex-3-ene-1-carbaldehyde.
| Compound Name | 1-methyl-4-tri(propan-2-yl)silyloxycyclohex-3-ene-1-carbaldehyde |
|---|---|
| PubChem CID | 10913494 |
| Molecular Formula | C17H32O2Si |
| Molecular Weight | 296.53 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | 1-methyl-4-tri(propan-2-yl)silyloxycyclohex-3-ene-1-carbaldehyde |
| SMILES | CC(C)[Si](OC1=CCC(C)(C=O)CC1)(C(C)C)C(C)C |
| InChI | InChI=1S/C17H32O2Si/c1-13(2)20(14(3)4,15(5)6)19-16-8-10-17(7,12-18)11-9-16/h8,12-15H,9-11H2,1-7H3 |
| InChIKey | AFDALRXZJLAYHX-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.53 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|