C11H18O3Si — CID 135036773
4-trimethylsilyloxycyclohex-4-ene-1,2-dicarbaldehyde (PubChem CID 135036773) has the molecular formula C11H18O3Si and a molecular weight of 226.35 g/mol. Its IUPAC name is 4-trimethylsilyloxycyclohex-4-ene-1,2-dicarbaldehyde.
| Compound Name | 4-trimethylsilyloxycyclohex-4-ene-1,2-dicarbaldehyde |
|---|---|
| PubChem CID | 135036773 |
| Molecular Formula | C11H18O3Si |
| Molecular Weight | 226.35 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 4-trimethylsilyloxycyclohex-4-ene-1,2-dicarbaldehyde |
| SMILES | C[Si](C)(C)OC1=CCC(C=O)C(C=O)C1 |
| InChI | InChI=1S/C11H18O3Si/c1-15(2,3)14-11-5-4-9(7-12)10(6-11)8-13/h5,7-10H,4,6H2,1-3H3 |
| InChIKey | BRZGYSIDPWFMNQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|