C23H44O3Si — CID 59123698
(4S,7R,8S,9S)-4-[tert-butyl(dimethyl)silyl]oxy-5,5,7,8,9-pentamethyldodec-11-ene-2,6-dione (PubChem CID 59123698) has the molecular formula C23H44O3Si and a molecular weight of 396.69 g/mol. Its IUPAC name is (4S,7R,8S,9S)-4-[tert-butyl(dimethyl)silyl]oxy-5,5,7,8,9-pentamethyldodec-11-ene-2,6-dione.
| Compound Name | (4S,7R,8S,9S)-4-[tert-butyl(dimethyl)silyl]oxy-5,5,7,8,9-pentamethyldodec-11-ene-2,6-dione |
|---|---|
| PubChem CID | 59123698 |
| Molecular Formula | C23H44O3Si |
| Molecular Weight | 396.69 g/mol |
| Exact Mass | 396.31 |
| IUPAC Name | (4S,7R,8S,9S)-4-[tert-butyl(dimethyl)silyl]oxy-5,5,7,8,9-pentamethyldodec-11-ene-2,6-dione |
| SMILES | C=CC[C@H](C)[C@H](C)[C@@H](C)C(=O)C(C)(C)[C@H](CC(C)=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H44O3Si/c1-13-14-16(2)18(4)19(5)21(25)23(9,10)20(15-17(3)24)26-27(11,12)22(6,7)8/h13,16,18-20H,1,14-15H2,2-12H3/t16-,18-,19+,20-/m0/s1 |
| InChIKey | YSYYRZYWMJFLIC-FFGOWVMKSA-N |
| XLogP | 6.44 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.69 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|