C26H42O2Si — CID 140733784
(1S,7R,8R,9R,10R,12R,14R)-8-[tert-butyl(dimethyl)silyl]oxy-3,7,11,11,14-pentamethyltetracyclo[7.5.1.01,5.010,12]pentadeca-2,4-dien-15-one (PubChem CID 140733784) has the molecular formula C26H42O2Si and a molecular weight of 414.71 g/mol. Its IUPAC name is (1S,7R,8R,9R,10R,12R,14R)-8-[tert-butyl(dimethyl)silyl]oxy-3,7,11,11,14-pentamethyltetracyclo[7.5.1.01,5.010,12]pentadeca-2,4-dien-15-one.
| Compound Name | (1S,7R,8R,9R,10R,12R,14R)-8-[tert-butyl(dimethyl)silyl]oxy-3,7,11,11,14-pentamethyltetracyclo[7.5.1.01,5.010,12]pentadeca-2,4-dien-15-one |
|---|---|
| PubChem CID | 140733784 |
| Molecular Formula | C26H42O2Si |
| Molecular Weight | 414.71 g/mol |
| Exact Mass | 414.30 |
| IUPAC Name | (1S,7R,8R,9R,10R,12R,14R)-8-[tert-butyl(dimethyl)silyl]oxy-3,7,11,11,14-pentamethyltetracyclo[7.5.1.01,5.010,12]pentadeca-2,4-dien-15-one |
| SMILES | CC1=C[C@]23C(=O)[C@@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)CC2=C1)[C@H]1[C@@H](C[C@H]3C)C1(C)C |
| InChI | InChI=1S/C26H42O2Si/c1-15-11-18-12-16(2)22(28-29(9,10)24(4,5)6)20-21-19(25(21,7)8)13-17(3)26(18,14-15)23(20)27/h11,14,16-17,19-22H,12-13H2,1-10H3/t16-,17-,19-,20-,21-,22-,26-/m1/s1 |
| InChIKey | PPEYMLRMAODTBO-JBQHCXKPSA-N |
| XLogP | 6.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.71 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|