C20H30O2 — CID 162418275
(1R,2R,4R,5R,9S,10R,12R,14R)-2-hydroxy-4,7,11,11,14-pentamethyltetracyclo[7.6.0.01,5.010,12]pentadec-6-en-15-one (PubChem CID 162418275) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (1R,2R,4R,5R,9S,10R,12R,14R)-2-hydroxy-4,7,11,11,14-pentamethyltetracyclo[7.6.0.01,5.010,12]pentadec-6-en-15-one.
| Compound Name | (1R,2R,4R,5R,9S,10R,12R,14R)-2-hydroxy-4,7,11,11,14-pentamethyltetracyclo[7.6.0.01,5.010,12]pentadec-6-en-15-one |
|---|---|
| PubChem CID | 162418275 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (1R,2R,4R,5R,9S,10R,12R,14R)-2-hydroxy-4,7,11,11,14-pentamethyltetracyclo[7.6.0.01,5.010,12]pentadec-6-en-15-one |
| SMILES | CC1=C[C@H]2[C@H](C)C[C@@H](O)[C@]23C(=O)[C@H](C)C[C@@H]2[C@H]([C@@H]3C1)C2(C)C |
| InChI | InChI=1S/C20H30O2/c1-10-6-13-11(2)9-16(21)20(13)15(7-10)17-14(19(17,4)5)8-12(3)18(20)22/h6,11-17,21H,7-9H2,1-5H3/t11-,12-,13+,14-,15+,16-,17-,20+/m1/s1 |
| InChIKey | VCVKSCFVVUKDMY-XVCNSHKYSA-N |
| XLogP | 3.84 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|