C26H48O2Si — CID 54577057
(3S,3aR,5R,9S,9aS)-9-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-dimethyl-5-(4-methylpent-3-enyl)-2,3,3a,4,7,8,9,9a-octahydro-1H-cyclopenta[8]annulen-6-one (PubChem CID 54577057) has the molecular formula C26H48O2Si and a molecular weight of 420.75 g/mol. Its IUPAC name is (3S,3aR,5R,9S,9aS)-9-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-dimethyl-5-(4-methylpent-3-enyl)-2,3,3a,4,7,8,9,9a-octahydro-1H-cyclopenta[8]annulen-6-one.
| Compound Name | (3S,3aR,5R,9S,9aS)-9-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-dimethyl-5-(4-methylpent-3-enyl)-2,3,3a,4,7,8,9,9a-octahydro-1H-cyclopenta[8]annulen-6-one |
|---|---|
| PubChem CID | 54577057 |
| Molecular Formula | C26H48O2Si |
| Molecular Weight | 420.75 g/mol |
| Exact Mass | 420.34 |
| IUPAC Name | (3S,3aR,5R,9S,9aS)-9-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-dimethyl-5-(4-methylpent-3-enyl)-2,3,3a,4,7,8,9,9a-octahydro-1H-cyclopenta[8]annulen-6-one |
| SMILES | CC(C)=CCC[C@]1(C)C[C@H]2[C@H](CC[C@@H]2C)[C@@H](CO[Si](C)(C)C(C)(C)C)CCC1=O |
| InChI | InChI=1S/C26H48O2Si/c1-19(2)11-10-16-26(7)17-23-20(3)12-14-22(23)21(13-15-24(26)27)18-28-29(8,9)25(4,5)6/h11,20-23H,10,12-18H2,1-9H3/t20-,21+,22+,23+,26+/m0/s1 |
| InChIKey | WQPBVRCMFKMSSL-UFEHMYJYSA-N |
| XLogP | 7.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.75 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|